5,7-dimethylquinolin-4-amine
Catalog No: FT-0726040
CAS No: 948292-64-6
- Chemical Name: 5,7-dimethylquinolin-4-amine
- Molecular Formula: C11H12N2
- Molecular Weight: 172.23
- InChI Key: FZSRMFQWMZKGCM-UHFFFAOYSA-N
- InChI: InChI=1S/C11H12N2/c1-7-5-8(2)11-9(12)3-4-13-10(11)6-7/h3-6H,1-2H3,(H2,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 948292-64-6 |
|---|---|
| MF: | C11H12N2 |
| Density: | 1.136g/cm3 |
| Flash_Point: | 197.6ºC |
| Melting_Point: | N/A |
| Product_Name: | 5,7-dimethylquinolin-4-amine |
| Symbol: | GHS07 |
| Bolling_Point: | 358ºC at 760 mmHg |
| FW: | 172.22600 |
| Density: | 1.136g/cm3 |
|---|---|
| MF: | C11H12N2 |
| LogP: | 3.01500 |
| Exact_Mass: | 172.10000 |
| Bolling_Point: | 358ºC at 760 mmHg |
| Flash_Point: | 197.6ºC |
| FW: | 172.22600 |
| Refractive_Index: | 1.661 |
| PSA: | 38.91000 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
Related Products
Carbonic dichloride,polymer with 4,4-(1-methylethylidene)bis2,6-dibromophenol and 4,4-(1-methylethylidene)bisphenol
2-amino-9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one